C13H15N3O — CID 116691858
3-(3,5-dimethyl-1,2,4-triazol-1-yl)-1-phenylpropan-1-one (PubChem CID 116691858) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-1-phenylpropan-1-one.
| Compound Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 116691858 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-1-phenylpropan-1-one |
| SMILES | Cc1nc(C)n(CCC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C13H15N3O/c1-10-14-11(2)16(15-10)9-8-13(17)12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3 |
| InChIKey | UGPHMMDDDKVNIC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |