C23H22N4O5 — CID 11669227
methyl 2-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzoate (PubChem CID 11669227) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is methyl 2-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzoate.
| Compound Name | methyl 2-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzoate |
|---|---|
| PubChem CID | 11669227 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | methyl 2-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1ccc2cnc(Nc3cc(OC)c(OC)c(OC)c3)nc21 |
| InChI | InChI=1S/C23H22N4O5/c1-29-18-11-15(12-19(30-2)20(18)31-3)25-23-24-13-14-9-10-27(21(14)26-23)17-8-6-5-7-16(17)22(28)32-4/h5-13H,1-4H3,(H,24,25,26) |
| InChIKey | OVQBGDVXEXINLO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |