C16H20N4 — CID 116692705
2-phenyl-2-(propylamino)-4-pyrazol-1-ylbutanenitrile (PubChem CID 116692705) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-phenyl-2-(propylamino)-4-pyrazol-1-ylbutanenitrile.
| Compound Name | 2-phenyl-2-(propylamino)-4-pyrazol-1-ylbutanenitrile |
|---|---|
| PubChem CID | 116692705 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-phenyl-2-(propylamino)-4-pyrazol-1-ylbutanenitrile |
| SMILES | CCCNC(C#N)(CCn1cccn1)c1ccccc1 |
| InChI | InChI=1S/C16H20N4/c1-2-10-18-16(14-17,15-7-4-3-5-8-15)9-13-20-12-6-11-19-20/h3-8,11-12,18H,2,9-10,13H2,1H3 |
| InChIKey | YJXPUQPVNGHMRS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |