C24H18F3N3O2 — CID 11669282
N-methyl-5-[2-[2-methyl-5-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]ethynyl]pyridine-2-carboxamide (PubChem CID 11669282) has the molecular formula C24H18F3N3O2 and a molecular weight of 437.42 g/mol. Its IUPAC name is N-methyl-5-[2-[2-methyl-5-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]ethynyl]pyridine-2-carboxamide.
| Compound Name | N-methyl-5-[2-[2-methyl-5-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]ethynyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11669282 |
| Molecular Formula | C24H18F3N3O2 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-methyl-5-[2-[2-methyl-5-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]ethynyl]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(C#Cc2cc(C(=O)Nc3cccc(C(F)(F)F)c3)ccc2C)cn1 |
| InChI | InChI=1S/C24H18F3N3O2/c1-15-6-9-18(22(31)30-20-5-3-4-19(13-20)24(25,26)27)12-17(15)10-7-16-8-11-21(29-14-16)23(32)28-2/h3-6,8-9,11-14H,1-2H3,(H,28,32)(H,30,31) |
| InChIKey | ZMHVJFIIASNLTM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|