About 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile
2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile (PubChem CID 116693277) has the molecular formula C16H18N4S
and a molecular weight of 298.42 g/mol. Its IUPAC name is 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile.
Molecular Properties
| Compound Name | 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile |
| PubChem CID | 116693277 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile |
| SMILES | Cc1cc(C)nc(SCCC(N)(C#N)c2ccccc2)n1 |
| InChI | InChI=1S/C16H18N4S/c1-12-10-13(2)20-15(19-12)21-9-8-16(18,11-17)14-6-4-3-5-7-14/h3-7,10H,8-9,18H2,1-2H3 |
| InChIKey | CGABHFCMAYBGIL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile?
The IUPAC name of 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile (CID 116693277) is 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile.
What is the SMILES notation for 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile?
The canonical SMILES for 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile is Cc1cc(C)nc(SCCC(N)(C#N)c2ccccc2)n1.
What is the InChIKey of 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile?
The InChIKey is CGABHFCMAYBGIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4S/c1-12-10-13(2)20-15(19-12)21-9-8-16(18,11-17)14-6-4-3-5-7-14/h3-7,10H,8-9,18H2,1-2H3.
What are the key properties of 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile?
2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile has a molecular weight of 298.42 g/mol, XLogP of 2.95, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylbutanenitrile is sourced from PubChem (CID 116693277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).