C16H24O2 — CID 116693317
3-(2-methylcyclohexyl)oxy-1-phenylpropan-1-ol (PubChem CID 116693317) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-(2-methylcyclohexyl)oxy-1-phenylpropan-1-ol.
| Compound Name | 3-(2-methylcyclohexyl)oxy-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 116693317 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 3-(2-methylcyclohexyl)oxy-1-phenylpropan-1-ol |
| SMILES | CC1CCCCC1OCCC(O)c1ccccc1 |
| InChI | InChI=1S/C16H24O2/c1-13-7-5-6-10-16(13)18-12-11-15(17)14-8-3-2-4-9-14/h2-4,8-9,13,15-17H,5-7,10-12H2,1H3 |
| InChIKey | XSXMCBYDNAZFRO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |