C16H23NO3S — CID 116694802
4-(oxetan-3-ylsulfanyl)-2-phenyl-2-(propylamino)butanoic acid (PubChem CID 116694802) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 4-(oxetan-3-ylsulfanyl)-2-phenyl-2-(propylamino)butanoic acid.
| Compound Name | 4-(oxetan-3-ylsulfanyl)-2-phenyl-2-(propylamino)butanoic acid |
|---|---|
| PubChem CID | 116694802 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-(oxetan-3-ylsulfanyl)-2-phenyl-2-(propylamino)butanoic acid |
| SMILES | CCCNC(CCSC1COC1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO3S/c1-2-9-17-16(15(18)19,13-6-4-3-5-7-13)8-10-21-14-11-20-12-14/h3-7,14,17H,2,8-12H2,1H3,(H,18,19) |
| InChIKey | BMDMUJSKYUIQPE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |