C17H29NO2 — CID 116695556
4-(3,3-dimethylbutoxy)-2-(methylamino)-2-phenylbutan-1-ol (PubChem CID 116695556) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 4-(3,3-dimethylbutoxy)-2-(methylamino)-2-phenylbutan-1-ol.
| Compound Name | 4-(3,3-dimethylbutoxy)-2-(methylamino)-2-phenylbutan-1-ol |
|---|---|
| PubChem CID | 116695556 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 4-(3,3-dimethylbutoxy)-2-(methylamino)-2-phenylbutan-1-ol |
| SMILES | CNC(CO)(CCOCCC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H29NO2/c1-16(2,3)10-12-20-13-11-17(14-19,18-4)15-8-6-5-7-9-15/h5-9,18-19H,10-14H2,1-4H3 |
| InChIKey | SFEOKFKMIQDRCI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|