C15H13Cl3O — CID 116696329
3-chloro-1-(2,5-dichlorophenyl)-1-phenylpropan-1-ol (PubChem CID 116696329) has the molecular formula C15H13Cl3O and a molecular weight of 315.63 g/mol. Its IUPAC name is 3-chloro-1-(2,5-dichlorophenyl)-1-phenylpropan-1-ol.
| Compound Name | 3-chloro-1-(2,5-dichlorophenyl)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 116696329 |
| Molecular Formula | C15H13Cl3O |
| Molecular Weight | 315.63 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 3-chloro-1-(2,5-dichlorophenyl)-1-phenylpropan-1-ol |
| SMILES | OC(CCCl)(c1ccccc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H13Cl3O/c16-9-8-15(19,11-4-2-1-3-5-11)13-10-12(17)6-7-14(13)18/h1-7,10,19H,8-9H2 |
| InChIKey | DCNILUZTIFLGAC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|