C17H18ClFO2 — CID 116696364
4-chloro-1-(3-fluoro-4-methoxyphenyl)-2-phenylbutan-2-ol (PubChem CID 116696364) has the molecular formula C17H18ClFO2 and a molecular weight of 308.78 g/mol. Its IUPAC name is 4-chloro-1-(3-fluoro-4-methoxyphenyl)-2-phenylbutan-2-ol.
| Compound Name | 4-chloro-1-(3-fluoro-4-methoxyphenyl)-2-phenylbutan-2-ol |
|---|---|
| PubChem CID | 116696364 |
| Molecular Formula | C17H18ClFO2 |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-chloro-1-(3-fluoro-4-methoxyphenyl)-2-phenylbutan-2-ol |
| SMILES | COc1ccc(CC(O)(CCCl)c2ccccc2)cc1F |
| InChI | InChI=1S/C17H18ClFO2/c1-21-16-8-7-13(11-15(16)19)12-17(20,9-10-18)14-5-3-2-4-6-14/h2-8,11,20H,9-10,12H2,1H3 |
| InChIKey | YRUSXTJOHLSERU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|