C9H6N4O3S — CID 116696597
2-(pyrimidin-2-ylcarbamoyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 116696597) has the molecular formula C9H6N4O3S and a molecular weight of 250.24 g/mol. Its IUPAC name is 2-(pyrimidin-2-ylcarbamoyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(pyrimidin-2-ylcarbamoyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116696597 |
| Molecular Formula | C9H6N4O3S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-(pyrimidin-2-ylcarbamoyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(C(=O)Nc2ncccn2)n1 |
| InChI | InChI=1S/C9H6N4O3S/c14-6(13-9-10-2-1-3-11-9)7-12-5(4-17-7)8(15)16/h1-4H,(H,15,16)(H,10,11,13,14) |
| InChIKey | VRVIRDDZOMXABB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |