About 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid
2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 116697239) has the molecular formula C10H9N3O5S
and a molecular weight of 283.26 g/mol. Its IUPAC name is 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 116697239 |
| Molecular Formula | C10H9N3O5S |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CN1C(=O)CC(NC(=O)c2nc(C(=O)O)cs2)C1=O |
| InChI | InChI=1S/C10H9N3O5S/c1-13-6(14)2-4(9(13)16)11-7(15)8-12-5(3-19-8)10(17)18/h3-4H,2H2,1H3,(H,11,15)(H,17,18) |
| InChIKey | YSKCTJRXAIXLGV-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid (CID 116697239) is 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid is CN1C(=O)CC(NC(=O)c2nc(C(=O)O)cs2)C1=O.
What is the InChIKey of 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is YSKCTJRXAIXLGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O5S/c1-13-6(14)2-4(9(13)16)11-7(15)8-12-5(3-19-8)10(17)18/h3-4H,2H2,1H3,(H,11,15)(H,17,18).
What are the key properties of 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid?
2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 283.26 g/mol, XLogP of -0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 116697239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).