C9H9F3N2O3S — CID 116697340
2-(4,4,4-trifluorobutylcarbamoyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 116697340) has the molecular formula C9H9F3N2O3S and a molecular weight of 282.24 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutylcarbamoyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(4,4,4-trifluorobutylcarbamoyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116697340 |
| Molecular Formula | C9H9F3N2O3S |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-(4,4,4-trifluorobutylcarbamoyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(C(=O)NCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H9F3N2O3S/c10-9(11,12)2-1-3-13-6(15)7-14-5(4-18-7)8(16)17/h4H,1-3H2,(H,13,15)(H,16,17) |
| InChIKey | MIRPQHKMAONPPS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|