C10H11F3N2O3S — CID 116697341
2-(5,5,5-trifluoropentylcarbamoyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 116697341) has the molecular formula C10H11F3N2O3S and a molecular weight of 296.27 g/mol. Its IUPAC name is 2-(5,5,5-trifluoropentylcarbamoyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(5,5,5-trifluoropentylcarbamoyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116697341 |
| Molecular Formula | C10H11F3N2O3S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-(5,5,5-trifluoropentylcarbamoyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(C(=O)NCCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F3N2O3S/c11-10(12,13)3-1-2-4-14-7(16)8-15-6(5-19-8)9(17)18/h5H,1-4H2,(H,14,16)(H,17,18) |
| InChIKey | LKDAVHWMFJIARJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|