About 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide
4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide (PubChem CID 11669792) has the molecular formula C28H36N4O2
and a molecular weight of 460.62 g/mol. Its IUPAC name is 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide |
| PubChem CID | 11669792 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide |
| SMILES | CCCC(CCC)c1cnc(-c2c(CC)cccc2CC)nc1Nc1ccc(C(N)=O)c(O)c1 |
| InChI | InChI=1S/C28H36N4O2/c1-5-10-20(11-6-2)23-17-30-28(25-18(7-3)12-9-13-19(25)8-4)32-27(23)31-21-14-15-22(26(29)34)24(33)16-21/h9,12-17,20,33H,5-8,10-11H2,1-4H3,(H2,29,34)(H,30,31,32) |
| InChIKey | ZOTKWPXSUMFBFM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide?
The IUPAC name of 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide (CID 11669792) is 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide.
What is the SMILES notation for 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide?
The canonical SMILES for 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide is CCCC(CCC)c1cnc(-c2c(CC)cccc2CC)nc1Nc1ccc(C(N)=O)c(O)c1.
What is the InChIKey of 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide?
The InChIKey is ZOTKWPXSUMFBFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H36N4O2/c1-5-10-20(11-6-2)23-17-30-28(25-18(7-3)12-9-13-19(25)8-4)32-27(23)31-21-14-15-22(26(29)34)24(33)16-21/h9,12-17,20,33H,5-8,10-11H2,1-4H3,(H2,29,34)(H,30,31,32).
What are the key properties of 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide?
4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide has a molecular weight of 460.62 g/mol, XLogP of 6.50, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(2,6-diethylphenyl)-5-heptan-4-ylpyrimidin-4-yl]amino]-2-hydroxybenzamide is sourced from PubChem (CID 11669792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).