C27H29ClN4O — CID 11669798
N-[5-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]-1H-indole-3-carboxamide (PubChem CID 11669798) has the molecular formula C27H29ClN4O and a molecular weight of 461.01 g/mol. Its IUPAC name is N-[5-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]-1H-indole-3-carboxamide.
| Compound Name | N-[5-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 11669798 |
| Molecular Formula | C27H29ClN4O |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-[5-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]-1H-indole-3-carboxamide |
| SMILES | O=C(NCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H29ClN4O/c28-18-12-13-21-25(16-18)32-24-11-5-3-9-20(24)26(21)29-14-6-1-7-15-30-27(33)22-17-31-23-10-4-2-8-19(22)23/h2,4,8,10,12-13,16-17,31H,1,3,5-7,9,11,14-15H2,(H,29,32)(H,30,33) |
| InChIKey | WRZLBZPGOSUCKT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|