About 3-morpholin-3-yl-2,3-dihydrochromen-4-one
3-morpholin-3-yl-2,3-dihydrochromen-4-one (PubChem CID 116698663) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-morpholin-3-yl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 3-morpholin-3-yl-2,3-dihydrochromen-4-one |
| PubChem CID | 116698663 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-morpholin-3-yl-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2ccccc2OCC1C1COCCN1 |
| InChI | InChI=1S/C13H15NO3/c15-13-9-3-1-2-4-12(9)17-7-10(13)11-8-16-6-5-14-11/h1-4,10-11,14H,5-8H2 |
| InChIKey | LVBYQDBVLXMXFE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-morpholin-3-yl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-3-yl-2,3-dihydrochromen-4-one?
The IUPAC name of 3-morpholin-3-yl-2,3-dihydrochromen-4-one (CID 116698663) is 3-morpholin-3-yl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 3-morpholin-3-yl-2,3-dihydrochromen-4-one?
The canonical SMILES for 3-morpholin-3-yl-2,3-dihydrochromen-4-one is O=C1c2ccccc2OCC1C1COCCN1.
What is the InChIKey of 3-morpholin-3-yl-2,3-dihydrochromen-4-one?
The InChIKey is LVBYQDBVLXMXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c15-13-9-3-1-2-4-12(9)17-7-10(13)11-8-16-6-5-14-11/h1-4,10-11,14H,5-8H2.
What are the key properties of 3-morpholin-3-yl-2,3-dihydrochromen-4-one?
3-morpholin-3-yl-2,3-dihydrochromen-4-one has a molecular weight of 233.27 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-3-yl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 116698663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).