C14H13ClF3NO — CID 116698821
3-chloro-N-[1-(furan-2-yl)propan-2-yl]-5-(trifluoromethyl)aniline (PubChem CID 116698821) has the molecular formula C14H13ClF3NO and a molecular weight of 303.71 g/mol. Its IUPAC name is 3-chloro-N-[1-(furan-2-yl)propan-2-yl]-5-(trifluoromethyl)aniline.
| Compound Name | 3-chloro-N-[1-(furan-2-yl)propan-2-yl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 116698821 |
| Molecular Formula | C14H13ClF3NO |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 3-chloro-N-[1-(furan-2-yl)propan-2-yl]-5-(trifluoromethyl)aniline |
| SMILES | CC(Cc1ccco1)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13ClF3NO/c1-9(5-13-3-2-4-20-13)19-12-7-10(14(16,17)18)6-11(15)8-12/h2-4,6-9,19H,5H2,1H3 |
| InChIKey | OTPCVNPUHNTLMP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |