C22H30O9S — CID 11670003
(1R,13R,15S,16R,17S)-6,7-dihydroxy-16,17-dimethoxy-15-phenylsulfanyl-2,11,14-trioxabicyclo[11.4.0]heptadecane-3,10-dione (PubChem CID 11670003) has the molecular formula C22H30O9S and a molecular weight of 470.54 g/mol. Its IUPAC name is (1R,13R,15S,16R,17S)-6,7-dihydroxy-16,17-dimethoxy-15-phenylsulfanyl-2,11,14-trioxabicyclo[11.4.0]heptadecane-3,10-dione.
| Compound Name | (1R,13R,15S,16R,17S)-6,7-dihydroxy-16,17-dimethoxy-15-phenylsulfanyl-2,11,14-trioxabicyclo[11.4.0]heptadecane-3,10-dione |
|---|---|
| PubChem CID | 11670003 |
| Molecular Formula | C22H30O9S |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (1R,13R,15S,16R,17S)-6,7-dihydroxy-16,17-dimethoxy-15-phenylsulfanyl-2,11,14-trioxabicyclo[11.4.0]heptadecane-3,10-dione |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](Sc2ccccc2)O[C@@H]2COC(=O)CCC(O)C(O)CCC(=O)O[C@@H]12 |
| InChI | InChI=1S/C22H30O9S/c1-27-20-19-16(30-22(21(20)28-2)32-13-6-4-3-5-7-13)12-29-17(25)10-8-14(23)15(24)9-11-18(26)31-19/h3-7,14-16,19-24H,8-12H2,1-2H3/t14?,15?,16-,19-,20+,21-,22+/m1/s1 |
| InChIKey | PWTIFTUCWAWRFB-ZBRCLKGPSA-N |
| XLogP | 1.28 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |