C29H29N7 — CID 11670098
5-[5-(3,3-dibenzylpiperazin-1-yl)-1,2,4-triazin-3-yl]-3-methyl-2H-indazole (PubChem CID 11670098) has the molecular formula C29H29N7 and a molecular weight of 475.60 g/mol. Its IUPAC name is 5-[5-(3,3-dibenzylpiperazin-1-yl)-1,2,4-triazin-3-yl]-3-methyl-2H-indazole.
| Compound Name | 5-[5-(3,3-dibenzylpiperazin-1-yl)-1,2,4-triazin-3-yl]-3-methyl-2H-indazole |
|---|---|
| PubChem CID | 11670098 |
| Molecular Formula | C29H29N7 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 5-[5-(3,3-dibenzylpiperazin-1-yl)-1,2,4-triazin-3-yl]-3-methyl-2H-indazole |
| SMILES | Cc1[nH]nc2ccc(-c3nncc(N4CCNC(Cc5ccccc5)(Cc5ccccc5)C4)n3)cc12 |
| InChI | InChI=1S/C29H29N7/c1-21-25-16-24(12-13-26(25)34-33-21)28-32-27(19-31-35-28)36-15-14-30-29(20-36,17-22-8-4-2-5-9-22)18-23-10-6-3-7-11-23/h2-13,16,19,30H,14-15,17-18,20H2,1H3,(H,33,34) |
| InChIKey | QCPVORHHIOYUCY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |