C15H21N3O3 — CID 116702620
2-[4-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]anilino]ethanol (PubChem CID 116702620) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[4-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]anilino]ethanol.
| Compound Name | 2-[4-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]anilino]ethanol |
|---|---|
| PubChem CID | 116702620 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-[4-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]anilino]ethanol |
| SMILES | CCCC(OC)c1noc(-c2ccc(NCCO)cc2)n1 |
| InChI | InChI=1S/C15H21N3O3/c1-3-4-13(20-2)14-17-15(21-18-14)11-5-7-12(8-6-11)16-9-10-19/h5-8,13,16,19H,3-4,9-10H2,1-2H3 |
| InChIKey | POVKTLBAJAXPAD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |