C11H19N3O3 — CID 116702661
3-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]morpholine (PubChem CID 116702661) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]morpholine.
| Compound Name | 3-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]morpholine |
|---|---|
| PubChem CID | 116702661 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 3-[3-(1-methoxybutyl)-1,2,4-oxadiazol-5-yl]morpholine |
| SMILES | CCCC(OC)c1noc(C2COCCN2)n1 |
| InChI | InChI=1S/C11H19N3O3/c1-3-4-9(15-2)10-13-11(17-14-10)8-7-16-6-5-12-8/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | MGVNTBQLXQKLRR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |