C27H48O6Si — CID 11670494
(1R,3S,5R,6S,8R,10S,12R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12-(hydroxymethyl)-3,5,13-trimethyl-6-[(Z)-pent-3-enyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-14-en-5-ol (PubChem CID 11670494) has the molecular formula C27H48O6Si and a molecular weight of 496.76 g/mol. Its IUPAC name is (1R,3S,5R,6S,8R,10S,12R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12-(hydroxymethyl)-3,5,13-trimethyl-6-[(Z)-pent-3-enyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-14-en-5-ol.
| Compound Name | (1R,3S,5R,6S,8R,10S,12R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12-(hydroxymethyl)-3,5,13-trimethyl-6-[(Z)-pent-3-enyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-14-en-5-ol |
|---|---|
| PubChem CID | 11670494 |
| Molecular Formula | C27H48O6Si |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | (1R,3S,5R,6S,8R,10S,12R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-12-(hydroxymethyl)-3,5,13-trimethyl-6-[(Z)-pent-3-enyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-14-en-5-ol |
| SMILES | C/C=C\CC[C@@H]1O[C@@H]2C[C@@H]3O[C@H](CO)[C@@](C)(O[Si](C)(C)C(C)(C)C)C=C[C@H]3O[C@@]2(C)C[C@@]1(C)O |
| InChI | InChI=1S/C27H48O6Si/c1-10-11-12-13-21-25(5,29)18-27(7)22(31-21)16-20-19(32-27)14-15-26(6,23(17-28)30-20)33-34(8,9)24(2,3)4/h10-11,14-15,19-23,28-29H,12-13,16-18H2,1-9H3/b11-10-/t19-,20+,21+,22-,23-,25-,26+,27+/m1/s1 |
| InChIKey | CFDWHYMFZWLQCY-BWQLSMPPSA-N |
| XLogP | 4.90 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|