About [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane
[4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane (PubChem CID 11670576) has the molecular formula C18H41N3O7P2Si
and a molecular weight of 501.57 g/mol. Its IUPAC name is [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane |
| PubChem CID | 11670576 |
| Molecular Formula | C18H41N3O7P2Si |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane |
| SMILES | CCOP(=O)(OCC)C(CCCN=[N+]=[N-])(O[Si](C)(C)C(C)(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H41N3O7P2Si/c1-10-24-29(22,25-11-2)18(15-14-16-20-21-19,28-31(8,9)17(5,6)7)30(23,26-12-3)27-13-4/h10-16H2,1-9H3 |
| InChIKey | NOSLIHKZUTVJCC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane?
The IUPAC name of [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane (CID 11670576) is [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane.
What is the SMILES notation for [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane?
The canonical SMILES for [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane is CCOP(=O)(OCC)C(CCCN=[N+]=[N-])(O[Si](C)(C)C(C)(C)C)P(=O)(OCC)OCC.
What is the InChIKey of [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane?
The InChIKey is NOSLIHKZUTVJCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H41N3O7P2Si/c1-10-24-29(22,25-11-2)18(15-14-16-20-21-19,28-31(8,9)17(5,6)7)30(23,26-12-3)27-13-4/h10-16H2,1-9H3.
What are the key properties of [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane?
[4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane has a molecular weight of 501.57 g/mol, XLogP of 7.28, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-azido-1,1-bis(diethoxyphosphoryl)butoxy]-tert-butyl-dimethylsilane is sourced from PubChem (CID 11670576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).