About 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine
4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine (PubChem CID 116706142) has the molecular formula C13H21ClN2O
and a molecular weight of 256.78 g/mol. Its IUPAC name is 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine |
| PubChem CID | 116706142 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine |
| SMILES | CCCc1cc(Cl)nc(C(OC)C(C)(C)C)n1 |
| InChI | InChI=1S/C13H21ClN2O/c1-6-7-9-8-10(14)16-12(15-9)11(17-5)13(2,3)4/h8,11H,6-7H2,1-5H3 |
| InChIKey | ZRDFXSGHVNGTCB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine?
The IUPAC name of 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine (CID 116706142) is 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine.
What is the SMILES notation for 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine?
The canonical SMILES for 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine is CCCc1cc(Cl)nc(C(OC)C(C)(C)C)n1.
What is the InChIKey of 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine?
The InChIKey is ZRDFXSGHVNGTCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN2O/c1-6-7-9-8-10(14)16-12(15-9)11(17-5)13(2,3)4/h8,11H,6-7H2,1-5H3.
What are the key properties of 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine?
4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine has a molecular weight of 256.78 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(1-methoxy-2,2-dimethylpropyl)-6-propylpyrimidine is sourced from PubChem (CID 116706142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).