C30H35NO4S — CID 11670639
4-[[3,5,5,8,8-pentamethyl-4-[(4-methylphenyl)sulfonylamino]-6,7-dihydronaphthalen-2-yl]methyl]benzoic acid (PubChem CID 11670639) has the molecular formula C30H35NO4S and a molecular weight of 505.68 g/mol. Its IUPAC name is 4-[[3,5,5,8,8-pentamethyl-4-[(4-methylphenyl)sulfonylamino]-6,7-dihydronaphthalen-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[3,5,5,8,8-pentamethyl-4-[(4-methylphenyl)sulfonylamino]-6,7-dihydronaphthalen-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 11670639 |
| Molecular Formula | C30H35NO4S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 4-[[3,5,5,8,8-pentamethyl-4-[(4-methylphenyl)sulfonylamino]-6,7-dihydronaphthalen-2-yl]methyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(C)c(Cc3ccc(C(=O)O)cc3)cc3c2C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C30H35NO4S/c1-19-7-13-24(14-8-19)36(34,35)31-27-20(2)23(17-21-9-11-22(12-10-21)28(32)33)18-25-26(27)30(5,6)16-15-29(25,3)4/h7-14,18,31H,15-17H2,1-6H3,(H,32,33) |
| InChIKey | WTZIWMGFWYHIQE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |