C11H19F3O2 — CID 116707742
6-ethoxy-1,1,1-trifluorononan-5-one (PubChem CID 116707742) has the molecular formula C11H19F3O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 6-ethoxy-1,1,1-trifluorononan-5-one.
| Compound Name | 6-ethoxy-1,1,1-trifluorononan-5-one |
|---|---|
| PubChem CID | 116707742 |
| Molecular Formula | C11H19F3O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 6-ethoxy-1,1,1-trifluorononan-5-one |
| SMILES | CCCC(OCC)C(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H19F3O2/c1-3-6-10(16-4-2)9(15)7-5-8-11(12,13)14/h10H,3-8H2,1-2H3 |
| InChIKey | WDOBDOBLVZAKGE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |