C15H22O2 — CID 116708167
2-methoxy-1-(2,4,5-trimethylphenyl)pentan-1-one (PubChem CID 116708167) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-methoxy-1-(2,4,5-trimethylphenyl)pentan-1-one.
| Compound Name | 2-methoxy-1-(2,4,5-trimethylphenyl)pentan-1-one |
|---|---|
| PubChem CID | 116708167 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-methoxy-1-(2,4,5-trimethylphenyl)pentan-1-one |
| SMILES | CCCC(OC)C(=O)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C15H22O2/c1-6-7-14(17-5)15(16)13-9-11(3)10(2)8-12(13)4/h8-9,14H,6-7H2,1-5H3 |
| InChIKey | MCSMITLGNWJSIM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |