C34H60Si2 — CID 11670913
[(3E,5E)-3-[(E)-pent-1-enyl]-4-[2-tri(propan-2-yl)silylethynyl]nona-3,5-dien-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 11670913) has the molecular formula C34H60Si2 and a molecular weight of 525.03 g/mol. Its IUPAC name is [(3E,5E)-3-[(E)-pent-1-enyl]-4-[2-tri(propan-2-yl)silylethynyl]nona-3,5-dien-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [(3E,5E)-3-[(E)-pent-1-enyl]-4-[2-tri(propan-2-yl)silylethynyl]nona-3,5-dien-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11670913 |
| Molecular Formula | C34H60Si2 |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.42 |
| IUPAC Name | [(3E,5E)-3-[(E)-pent-1-enyl]-4-[2-tri(propan-2-yl)silylethynyl]nona-3,5-dien-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | CCC/C=C/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(C#C[Si](C(C)C)(C(C)C)C(C)C)/C=C/CCC |
| InChI | InChI=1S/C34H60Si2/c1-15-17-19-21-33(23-25-35(27(3)4,28(5)6)29(7)8)34(22-20-18-16-2)24-26-36(30(9)10,31(11)12)32(13)14/h19-22,27-32H,15-18H2,1-14H3/b21-19+,22-20+,34-33+ |
| InChIKey | LUYBXGAYXZHDDD-JUQCLHPOSA-N |
| XLogP | 11.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|