C11H19F3O2 — CID 116709527
8,8,8-trifluoro-3-methoxy-2,2-dimethyloctan-4-one (PubChem CID 116709527) has the molecular formula C11H19F3O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 8,8,8-trifluoro-3-methoxy-2,2-dimethyloctan-4-one.
| Compound Name | 8,8,8-trifluoro-3-methoxy-2,2-dimethyloctan-4-one |
|---|---|
| PubChem CID | 116709527 |
| Molecular Formula | C11H19F3O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 8,8,8-trifluoro-3-methoxy-2,2-dimethyloctan-4-one |
| SMILES | COC(C(=O)CCCC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C11H19F3O2/c1-10(2,3)9(16-4)8(15)6-5-7-11(12,13)14/h9H,5-7H2,1-4H3 |
| InChIKey | FUWSLUYCSLUYDA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |