C12H21F3O2 — CID 116709826
3-ethoxy-8,8,8-trifluoro-2,2-dimethyloctan-4-one (PubChem CID 116709826) has the molecular formula C12H21F3O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-ethoxy-8,8,8-trifluoro-2,2-dimethyloctan-4-one.
| Compound Name | 3-ethoxy-8,8,8-trifluoro-2,2-dimethyloctan-4-one |
|---|---|
| PubChem CID | 116709826 |
| Molecular Formula | C12H21F3O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-ethoxy-8,8,8-trifluoro-2,2-dimethyloctan-4-one |
| SMILES | CCOC(C(=O)CCCC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C12H21F3O2/c1-5-17-10(11(2,3)4)9(16)7-6-8-12(13,14)15/h10H,5-8H2,1-4H3 |
| InChIKey | JERPLLUYUZQLSN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |