C28H36O11 — CID 11671176
[(1S,2S,3S,7S,8R,9R,10S,12Z,14S,17R)-2,9,10-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-7-yl] acetate (PubChem CID 11671176) has the molecular formula C28H36O11 and a molecular weight of 548.59 g/mol. Its IUPAC name is [(1S,2S,3S,7S,8R,9R,10S,12Z,14S,17R)-2,9,10-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-7-yl] acetate.
| Compound Name | [(1S,2S,3S,7S,8R,9R,10S,12Z,14S,17R)-2,9,10-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-7-yl] acetate |
|---|---|
| PubChem CID | 11671176 |
| Molecular Formula | C28H36O11 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | [(1S,2S,3S,7S,8R,9R,10S,12Z,14S,17R)-2,9,10-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1C/C(C)=C\[C@@H]2OC(=O)[C@]3(C)O[C@]23[C@@H](OC(C)=O)[C@H]2C(C)=CC[C@H](OC(C)=O)[C@]2(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H36O11/c1-13-11-19(34-15(3)29)23(36-17(5)31)26(7)20(35-16(4)30)10-9-14(2)22(26)24(37-18(6)32)28-21(12-13)38-25(33)27(28,8)39-28/h9,12,19-24H,10-11H2,1-8H3/b13-12-/t19-,20-,21-,22+,23-,24-,26-,27-,28-/m0/s1 |
| InChIKey | ZWAKJZFEDLSNFY-LCLRRLDDSA-N |
| XLogP | 2.49 |
| TPSA | 144.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|