C17H26N2O2 — CID 116712988
1-(1-ethylindazol-3-yl)-3-methoxy-4,4-dimethylpentan-2-ol (PubChem CID 116712988) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(1-ethylindazol-3-yl)-3-methoxy-4,4-dimethylpentan-2-ol.
| Compound Name | 1-(1-ethylindazol-3-yl)-3-methoxy-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 116712988 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-(1-ethylindazol-3-yl)-3-methoxy-4,4-dimethylpentan-2-ol |
| SMILES | CCn1nc(CC(O)C(OC)C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H26N2O2/c1-6-19-14-10-8-7-9-12(14)13(18-19)11-15(20)16(21-5)17(2,3)4/h7-10,15-16,20H,6,11H2,1-5H3 |
| InChIKey | HDOIAWKRYKKEOO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |