C17H32N2O2 — CID 116713320
3-ethoxy-4,4-dimethyl-1-(1-pentan-3-ylpyrazol-3-yl)pentan-2-ol (PubChem CID 116713320) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is 3-ethoxy-4,4-dimethyl-1-(1-pentan-3-ylpyrazol-3-yl)pentan-2-ol.
| Compound Name | 3-ethoxy-4,4-dimethyl-1-(1-pentan-3-ylpyrazol-3-yl)pentan-2-ol |
|---|---|
| PubChem CID | 116713320 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 3-ethoxy-4,4-dimethyl-1-(1-pentan-3-ylpyrazol-3-yl)pentan-2-ol |
| SMILES | CCOC(C(O)Cc1ccn(C(CC)CC)n1)C(C)(C)C |
| InChI | InChI=1S/C17H32N2O2/c1-7-14(8-2)19-11-10-13(18-19)12-15(20)16(21-9-3)17(4,5)6/h10-11,14-16,20H,7-9,12H2,1-6H3 |
| InChIKey | BVMFCESEDWGGGI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |