C16H26O4 — CID 116713378
1-(2,4-dimethoxyphenyl)-2-ethoxy-3,3-dimethylbutan-1-ol (PubChem CID 116713378) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-ethoxy-3,3-dimethylbutan-1-ol.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-ethoxy-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 116713378 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-ethoxy-3,3-dimethylbutan-1-ol |
| SMILES | CCOC(C(O)c1ccc(OC)cc1OC)C(C)(C)C |
| InChI | InChI=1S/C16H26O4/c1-7-20-15(16(2,3)4)14(17)12-9-8-11(18-5)10-13(12)19-6/h8-10,14-15,17H,7H2,1-6H3 |
| InChIKey | WQCHASWUDVIACY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |