C17H23NO2 — CID 116713427
2-ethoxy-3,3-dimethyl-1-quinolin-3-ylbutan-1-ol (PubChem CID 116713427) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-1-quinolin-3-ylbutan-1-ol.
| Compound Name | 2-ethoxy-3,3-dimethyl-1-quinolin-3-ylbutan-1-ol |
|---|---|
| PubChem CID | 116713427 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-1-quinolin-3-ylbutan-1-ol |
| SMILES | CCOC(C(O)c1cnc2ccccc2c1)C(C)(C)C |
| InChI | InChI=1S/C17H23NO2/c1-5-20-16(17(2,3)4)15(19)13-10-12-8-6-7-9-14(12)18-11-13/h6-11,15-16,19H,5H2,1-4H3 |
| InChIKey | QSWUKIYIBBIIRU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |