C31H39N3O6S2 — CID 11671693
9-benzyl-1,5-bis[(4-methoxyphenyl)sulfonyl]-3-methylidene-1,5,9-triazacyclododecane (PubChem CID 11671693) has the molecular formula C31H39N3O6S2 and a molecular weight of 613.80 g/mol. Its IUPAC name is 9-benzyl-1,5-bis[(4-methoxyphenyl)sulfonyl]-3-methylidene-1,5,9-triazacyclododecane.
| Compound Name | 9-benzyl-1,5-bis[(4-methoxyphenyl)sulfonyl]-3-methylidene-1,5,9-triazacyclododecane |
|---|---|
| PubChem CID | 11671693 |
| Molecular Formula | C31H39N3O6S2 |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | 9-benzyl-1,5-bis[(4-methoxyphenyl)sulfonyl]-3-methylidene-1,5,9-triazacyclododecane |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(OC)cc2)CCCN(Cc2ccccc2)CCCN(S(=O)(=O)c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C31H39N3O6S2/c1-26-23-33(41(35,36)30-15-11-28(39-2)12-16-30)21-7-19-32(25-27-9-5-4-6-10-27)20-8-22-34(24-26)42(37,38)31-17-13-29(40-3)14-18-31/h4-6,9-18H,1,7-8,19-25H2,2-3H3 |
| InChIKey | IZDUKJVDLGBCAP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|