C12H27NO2 — CID 116717107
1,3-diethoxy-N-propylpentan-2-amine (PubChem CID 116717107) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 1,3-diethoxy-N-propylpentan-2-amine.
| Compound Name | 1,3-diethoxy-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 116717107 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1,3-diethoxy-N-propylpentan-2-amine |
| SMILES | CCCNC(COCC)C(CC)OCC |
| InChI | InChI=1S/C12H27NO2/c1-5-9-13-11(10-14-7-3)12(6-2)15-8-4/h11-13H,5-10H2,1-4H3 |
| InChIKey | NGQRAXCYEIGEFU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |