C21H25F13N+ — CID 11671721
1-(11,11,12,12,13,13,14,14,15,15,16,16,16-tridecafluorohexadecyl)pyridin-1-ium (PubChem CID 11671721) has the molecular formula C21H25F13N+ and a molecular weight of 538.41 g/mol. Its IUPAC name is 1-(11,11,12,12,13,13,14,14,15,15,16,16,16-tridecafluorohexadecyl)pyridin-1-ium.
| Compound Name | 1-(11,11,12,12,13,13,14,14,15,15,16,16,16-tridecafluorohexadecyl)pyridin-1-ium |
|---|---|
| PubChem CID | 11671721 |
| Molecular Formula | C21H25F13N+ |
| Molecular Weight | 538.41 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 1-(11,11,12,12,13,13,14,14,15,15,16,16,16-tridecafluorohexadecyl)pyridin-1-ium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCCCCCC[n+]1ccccc1 |
| InChI | InChI=1S/C21H25F13N/c22-16(23,17(24,25)18(26,27)19(28,29)20(30,31)21(32,33)34)12-8-5-3-1-2-4-6-9-13-35-14-10-7-11-15-35/h7,10-11,14-15H,1-6,8-9,12-13H2/q+1 |
| InChIKey | BEVBXJWAEWKBQE-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.41 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|