C14H30N2O3S — CID 116717542
3-ethoxy-1-(1-methylsulfonylpiperidin-3-yl)hexan-2-amine (PubChem CID 116717542) has the molecular formula C14H30N2O3S and a molecular weight of 306.47 g/mol. Its IUPAC name is 3-ethoxy-1-(1-methylsulfonylpiperidin-3-yl)hexan-2-amine.
| Compound Name | 3-ethoxy-1-(1-methylsulfonylpiperidin-3-yl)hexan-2-amine |
|---|---|
| PubChem CID | 116717542 |
| Molecular Formula | C14H30N2O3S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 3-ethoxy-1-(1-methylsulfonylpiperidin-3-yl)hexan-2-amine |
| SMILES | CCCC(OCC)C(N)CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H30N2O3S/c1-4-7-14(19-5-2)13(15)10-12-8-6-9-16(11-12)20(3,17)18/h12-14H,4-11,15H2,1-3H3 |
| InChIKey | BRBVMSWJHFRGDY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |