C36H42N2O6Zn+2 — CID 11671941
zinc bis((4R,4aR,7aR,12bS)-9-methoxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one) (PubChem CID 11671941) has the molecular formula C36H42N2O6Zn+2 and a molecular weight of 664.13 g/mol. Its IUPAC name is zinc bis((4R,4aR,7aR,12bS)-9-methoxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one).
| Compound Name | zinc bis((4R,4aR,7aR,12bS)-9-methoxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one) |
|---|---|
| PubChem CID | 11671941 |
| Molecular Formula | C36H42N2O6Zn+2 |
| Molecular Weight | 664.13 g/mol |
| Exact Mass | 662.23 |
| IUPAC Name | zinc bis((4R,4aR,7aR,12bS)-9-methoxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one) |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC[C@H]4[C@@H](C2)N(C)CC[C@]314.COc1ccc2c3c1O[C@H]1C(=O)CC[C@H]4[C@@H](C2)N(C)CC[C@]314.[Zn+2] |
| InChI | InChI=1S/2C18H21NO3.Zn/c2*1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19;/h2*3,6,11-12,17H,4-5,7-9H2,1-2H3;/q;;+2/t2*11-,12+,17-,18-;/m00./s1 |
| InChIKey | XXWLLCNUXGTCFA-XCEVQLMMSA-N |
| XLogP | 3.86 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.13 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|