C17H33N3O — CID 116719573
1-(1-butan-2-ylpyrazol-3-yl)-3-methoxy-N-propylhexan-2-amine (PubChem CID 116719573) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-(1-butan-2-ylpyrazol-3-yl)-3-methoxy-N-propylhexan-2-amine.
| Compound Name | 1-(1-butan-2-ylpyrazol-3-yl)-3-methoxy-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 116719573 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 1-(1-butan-2-ylpyrazol-3-yl)-3-methoxy-N-propylhexan-2-amine |
| SMILES | CCCNC(Cc1ccn(C(C)CC)n1)C(CCC)OC |
| InChI | InChI=1S/C17H33N3O/c1-6-9-17(21-5)16(18-11-7-2)13-15-10-12-20(19-15)14(4)8-3/h10,12,14,16-18H,6-9,11,13H2,1-5H3 |
| InChIKey | AXEXIIPZYYORBO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |