C45H58O3Si — CID 11671982
tert-butyl-[(2S,3S,4R)-4-(cyclohexen-1-yl)-3,4-dimethyl-5-phenylmethoxy-1-trityloxypentan-2-yl]oxy-dimethylsilane (PubChem CID 11671982) has the molecular formula C45H58O3Si and a molecular weight of 675.04 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4R)-4-(cyclohexen-1-yl)-3,4-dimethyl-5-phenylmethoxy-1-trityloxypentan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,4R)-4-(cyclohexen-1-yl)-3,4-dimethyl-5-phenylmethoxy-1-trityloxypentan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11671982 |
| Molecular Formula | C45H58O3Si |
| Molecular Weight | 675.04 g/mol |
| Exact Mass | 674.42 |
| IUPAC Name | tert-butyl-[(2S,3S,4R)-4-(cyclohexen-1-yl)-3,4-dimethyl-5-phenylmethoxy-1-trityloxypentan-2-yl]oxy-dimethylsilane |
| SMILES | C[C@H]([C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](C)(C)C(C)(C)C)[C@@](C)(COCc1ccccc1)C1=CCCCC1 |
| InChI | InChI=1S/C45H58O3Si/c1-36(44(5,38-25-15-9-16-26-38)35-46-33-37-23-13-8-14-24-37)42(48-49(6,7)43(2,3)4)34-47-45(39-27-17-10-18-28-39,40-29-19-11-20-30-40)41-31-21-12-22-32-41/h8,10-14,17-25,27-32,36,42H,9,15-16,26,33-35H2,1-7H3/t36-,42-,44-/m1/s1 |
| InChIKey | PTWGTXKEVYYUET-LUGBWMRRSA-N |
| XLogP | 11.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.04 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|