C10H20F3NO — CID 116719984
1,1,1-trifluoro-5-methoxy-N,6-dimethylheptan-4-amine (PubChem CID 116719984) has the molecular formula C10H20F3NO and a molecular weight of 227.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-methoxy-N,6-dimethylheptan-4-amine.
| Compound Name | 1,1,1-trifluoro-5-methoxy-N,6-dimethylheptan-4-amine |
|---|---|
| PubChem CID | 116719984 |
| Molecular Formula | C10H20F3NO |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1,1,1-trifluoro-5-methoxy-N,6-dimethylheptan-4-amine |
| SMILES | CNC(CCC(F)(F)F)C(OC)C(C)C |
| InChI | InChI=1S/C10H20F3NO/c1-7(2)9(15-4)8(14-3)5-6-10(11,12)13/h7-9,14H,5-6H2,1-4H3 |
| InChIKey | FQYFHJCUSAUNDC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |