About 4-methoxy-N,2,5-trimethylhexan-3-amine
4-methoxy-N,2,5-trimethylhexan-3-amine (PubChem CID 116720030) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is 4-methoxy-N,2,5-trimethylhexan-3-amine.
Molecular Properties
| Compound Name | 4-methoxy-N,2,5-trimethylhexan-3-amine |
| PubChem CID | 116720030 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 4-methoxy-N,2,5-trimethylhexan-3-amine |
| SMILES | CNC(C(C)C)C(OC)C(C)C |
| InChI | InChI=1S/C10H23NO/c1-7(2)9(11-5)10(12-6)8(3)4/h7-11H,1-6H3 |
| InChIKey | NJBSBNFWQZTDGO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-N,2,5-trimethylhexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N,2,5-trimethylhexan-3-amine?
The IUPAC name of 4-methoxy-N,2,5-trimethylhexan-3-amine (CID 116720030) is 4-methoxy-N,2,5-trimethylhexan-3-amine.
What is the SMILES notation for 4-methoxy-N,2,5-trimethylhexan-3-amine?
The canonical SMILES for 4-methoxy-N,2,5-trimethylhexan-3-amine is CNC(C(C)C)C(OC)C(C)C.
What is the InChIKey of 4-methoxy-N,2,5-trimethylhexan-3-amine?
The InChIKey is NJBSBNFWQZTDGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO/c1-7(2)9(11-5)10(12-6)8(3)4/h7-11H,1-6H3.
What are the key properties of 4-methoxy-N,2,5-trimethylhexan-3-amine?
4-methoxy-N,2,5-trimethylhexan-3-amine has a molecular weight of 173.30 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N,2,5-trimethylhexan-3-amine is sourced from PubChem (CID 116720030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).