About N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine
N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine (PubChem CID 116720182) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine.
Molecular Properties
| Compound Name | N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine |
| PubChem CID | 116720182 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine |
| SMILES | CCNC(CC(C)C)C(OC)C(C)C |
| InChI | InChI=1S/C12H27NO/c1-7-13-11(8-9(2)3)12(14-6)10(4)5/h9-13H,7-8H2,1-6H3 |
| InChIKey | ALJGALIOGWRAQI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine?
The IUPAC name of N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine (CID 116720182) is N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine.
What is the SMILES notation for N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine?
The canonical SMILES for N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine is CCNC(CC(C)C)C(OC)C(C)C.
What is the InChIKey of N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine?
The InChIKey is ALJGALIOGWRAQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO/c1-7-13-11(8-9(2)3)12(14-6)10(4)5/h9-13H,7-8H2,1-6H3.
What are the key properties of N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine?
N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine has a molecular weight of 201.35 g/mol, XLogP of 2.68, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-methoxy-2,6-dimethylheptan-4-amine is sourced from PubChem (CID 116720182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).