C17H29NO — CID 116721056
2-ethoxy-N,3-dimethyl-1-(4-propan-2-ylphenyl)butan-1-amine (PubChem CID 116721056) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-ethoxy-N,3-dimethyl-1-(4-propan-2-ylphenyl)butan-1-amine.
| Compound Name | 2-ethoxy-N,3-dimethyl-1-(4-propan-2-ylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 116721056 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-ethoxy-N,3-dimethyl-1-(4-propan-2-ylphenyl)butan-1-amine |
| SMILES | CCOC(C(C)C)C(NC)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H29NO/c1-7-19-17(13(4)5)16(18-6)15-10-8-14(9-11-15)12(2)3/h8-13,16-18H,7H2,1-6H3 |
| InChIKey | SJFLMIFZXKQUQJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |