C47H90N2O2 — CID 11672109
N,N,N',N'-tetraethyl-2,6-bis[(Z)-hexadec-7-enyl]heptanediamide (PubChem CID 11672109) has the molecular formula C47H90N2O2 and a molecular weight of 715.25 g/mol. Its IUPAC name is N,N,N',N'-tetraethyl-2,6-bis[(Z)-hexadec-7-enyl]heptanediamide.
| Compound Name | N,N,N',N'-tetraethyl-2,6-bis[(Z)-hexadec-7-enyl]heptanediamide |
|---|---|
| PubChem CID | 11672109 |
| Molecular Formula | C47H90N2O2 |
| Molecular Weight | 715.25 g/mol |
| Exact Mass | 714.70 |
| IUPAC Name | N,N,N',N'-tetraethyl-2,6-bis[(Z)-hexadec-7-enyl]heptanediamide |
| SMILES | CCCCCCCC/C=C\CCCCCCC(CCCC(CCCCCC/C=C\CCCCCCCC)C(=O)N(CC)CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C47H90N2O2/c1-7-13-15-17-19-21-23-25-27-29-31-33-35-37-40-44(46(50)48(9-3)10-4)42-39-43-45(47(51)49(11-5)12-6)41-38-36-34-32-30-28-26-24-22-20-18-16-14-8-2/h25-28,44-45H,7-24,29-43H2,1-6H3/b27-25-,28-26- |
| InChIKey | OHORXFICZUDJCQ-LBXGSASVSA-N |
| XLogP | 14.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.25 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|