C52H104N2O — CID 11672241
(Z)-3-[(Z)-1-[di(propan-2-yl)amino]icos-11-en-3-yl]oxy-N,N-di(propan-2-yl)icos-11-en-1-amine (PubChem CID 11672241) has the molecular formula C52H104N2O and a molecular weight of 773.42 g/mol. Its IUPAC name is (Z)-3-[(Z)-1-[di(propan-2-yl)amino]icos-11-en-3-yl]oxy-N,N-di(propan-2-yl)icos-11-en-1-amine.
| Compound Name | (Z)-3-[(Z)-1-[di(propan-2-yl)amino]icos-11-en-3-yl]oxy-N,N-di(propan-2-yl)icos-11-en-1-amine |
|---|---|
| PubChem CID | 11672241 |
| Molecular Formula | C52H104N2O |
| Molecular Weight | 773.42 g/mol |
| Exact Mass | 772.81 |
| IUPAC Name | (Z)-3-[(Z)-1-[di(propan-2-yl)amino]icos-11-en-3-yl]oxy-N,N-di(propan-2-yl)icos-11-en-1-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(CCN(C(C)C)C(C)C)OC(CCCCCCC/C=C\CCCCCCCC)CCN(C(C)C)C(C)C |
| InChI | InChI=1S/C52H104N2O/c1-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-51(43-45-53(47(3)4)48(5)6)55-52(44-46-54(49(7)8)50(9)10)42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-2/h25-28,47-52H,11-24,29-46H2,1-10H3/b27-25-,28-26- |
| InChIKey | IWMIPVXOHCUXTG-LBXGSASVSA-N |
| XLogP | 16.83 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.42 |
| LogP ≤ 5 | 16.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|