C16H25BrClNO — CID 116725530
1-(4-bromo-2-chlorophenyl)-3-ethoxy-N,4,4-trimethylpentan-2-amine (PubChem CID 116725530) has the molecular formula C16H25BrClNO and a molecular weight of 362.74 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-ethoxy-N,4,4-trimethylpentan-2-amine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-ethoxy-N,4,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 116725530 |
| Molecular Formula | C16H25BrClNO |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-ethoxy-N,4,4-trimethylpentan-2-amine |
| SMILES | CCOC(C(Cc1ccc(Br)cc1Cl)NC)C(C)(C)C |
| InChI | InChI=1S/C16H25BrClNO/c1-6-20-15(16(2,3)4)14(19-5)9-11-7-8-12(17)10-13(11)18/h7-8,10,14-15,19H,6,9H2,1-5H3 |
| InChIKey | ZYVDMXGYDITCMW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |